C37H65NO2Si4 — CID 135012334
[(1S,2R,3S,5R,8R)-3,5-bis[[dimethyl(phenyl)silyl]methyl]-1-triethylsilyloxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]oxy-triethylsilane (PubChem CID 135012334) has the molecular formula C37H65NO2Si4 and a molecular weight of 668.28 g/mol. Its IUPAC name is [(1S,2R,3S,5R,8R)-3,5-bis[[dimethyl(phenyl)silyl]methyl]-1-triethylsilyloxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]oxy-triethylsilane.
| Compound Name | [(1S,2R,3S,5R,8R)-3,5-bis[[dimethyl(phenyl)silyl]methyl]-1-triethylsilyloxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 135012334 |
| Molecular Formula | C37H65NO2Si4 |
| Molecular Weight | 668.28 g/mol |
| Exact Mass | 667.41 |
| IUPAC Name | [(1S,2R,3S,5R,8R)-3,5-bis[[dimethyl(phenyl)silyl]methyl]-1-triethylsilyloxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](O[Si](CC)(CC)CC)[C@@H](C[Si](C)(C)c2ccccc2)N2[C@@H](C[Si](C)(C)c3ccccc3)CC[C@H]12 |
| InChI | InChI=1S/C37H65NO2Si4/c1-11-43(12-2,13-3)39-36-34-28-27-31(29-41(7,8)32-23-19-17-20-24-32)38(34)35(37(36)40-44(14-4,15-5)16-6)30-42(9,10)33-25-21-18-22-26-33/h17-26,31,34-37H,11-16,27-30H2,1-10H3/t31-,34-,35-,36+,37-/m1/s1 |
| InChIKey | YMSNVHALYCDJCG-OZHXDKPASA-N |
| XLogP | 9.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.28 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|