C16H25NOSi — CID 135012335
(1R,3S,8R)-3-[[dimethyl(phenyl)silyl]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ol (PubChem CID 135012335) has the molecular formula C16H25NOSi and a molecular weight of 275.47 g/mol. Its IUPAC name is (1R,3S,8R)-3-[[dimethyl(phenyl)silyl]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ol.
| Compound Name | (1R,3S,8R)-3-[[dimethyl(phenyl)silyl]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ol |
|---|---|
| PubChem CID | 135012335 |
| Molecular Formula | C16H25NOSi |
| Molecular Weight | 275.47 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (1R,3S,8R)-3-[[dimethyl(phenyl)silyl]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ol |
| SMILES | C[Si](C)(C[C@@H]1C[C@@H](O)[C@H]2CCCN12)c1ccccc1 |
| InChI | InChI=1S/C16H25NOSi/c1-19(2,14-7-4-3-5-8-14)12-13-11-16(18)15-9-6-10-17(13)15/h3-5,7-8,13,15-16,18H,6,9-12H2,1-2H3/t13-,15+,16+/m0/s1 |
| InChIKey | KQNPRRQXPXRBJQ-NUEKZKHPSA-N |
| XLogP | 2.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|