C20H27NOSi — CID 152797697
(1S)-2-[methyl(diphenyl)silyl]-1-[(2S)-1-methylpyrrolidin-2-yl]ethanol (PubChem CID 152797697) has the molecular formula C20H27NOSi and a molecular weight of 325.53 g/mol. Its IUPAC name is (1S)-2-[methyl(diphenyl)silyl]-1-[(2S)-1-methylpyrrolidin-2-yl]ethanol.
| Compound Name | (1S)-2-[methyl(diphenyl)silyl]-1-[(2S)-1-methylpyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 152797697 |
| Molecular Formula | C20H27NOSi |
| Molecular Weight | 325.53 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (1S)-2-[methyl(diphenyl)silyl]-1-[(2S)-1-methylpyrrolidin-2-yl]ethanol |
| SMILES | CN1CCC[C@H]1[C@H](O)C[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H27NOSi/c1-21-15-9-14-19(21)20(22)16-23(2,17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,19-20,22H,9,14-16H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | SMOOCXTUUHRZHB-VQTJNVASSA-N |
| XLogP | 2.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|