C20H21BrO4 — CID 71713736
ethyl (E)-4-(2-bromo-4-methoxy-5-phenylmethoxyphenyl)but-2-enoate (PubChem CID 71713736) has the molecular formula C20H21BrO4 and a molecular weight of 405.29 g/mol. Its IUPAC name is ethyl (E)-4-(2-bromo-4-methoxy-5-phenylmethoxyphenyl)but-2-enoate.
| Compound Name | ethyl (E)-4-(2-bromo-4-methoxy-5-phenylmethoxyphenyl)but-2-enoate |
|---|---|
| PubChem CID | 71713736 |
| Molecular Formula | C20H21BrO4 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | ethyl (E)-4-(2-bromo-4-methoxy-5-phenylmethoxyphenyl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/Cc1cc(OCc2ccccc2)c(OC)cc1Br |
| InChI | InChI=1S/C20H21BrO4/c1-3-24-20(22)11-7-10-16-12-19(18(23-2)13-17(16)21)25-14-15-8-5-4-6-9-15/h4-9,11-13H,3,10,14H2,1-2H3/b11-7+ |
| InChIKey | PRYGSHXLCZFNLY-YRNVUSSQSA-N |
| XLogP | 4.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|