C31H39BrO5 — CID 102259154
ethyl (2E,6E,10E)-12-(5-bromo-2-methoxy-4-phenylmethoxyphenoxy)-3,7,11-trimethyldodeca-2,6,10-trienoate (PubChem CID 102259154) has the molecular formula C31H39BrO5 and a molecular weight of 571.55 g/mol. Its IUPAC name is ethyl (2E,6E,10E)-12-(5-bromo-2-methoxy-4-phenylmethoxyphenoxy)-3,7,11-trimethyldodeca-2,6,10-trienoate.
| Compound Name | ethyl (2E,6E,10E)-12-(5-bromo-2-methoxy-4-phenylmethoxyphenoxy)-3,7,11-trimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 102259154 |
| Molecular Formula | C31H39BrO5 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | ethyl (2E,6E,10E)-12-(5-bromo-2-methoxy-4-phenylmethoxyphenoxy)-3,7,11-trimethyldodeca-2,6,10-trienoate |
| SMILES | CCOC(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)COc1cc(Br)c(OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C31H39BrO5/c1-6-35-31(33)18-24(3)14-10-12-23(2)13-11-15-25(4)21-36-30-19-27(32)28(20-29(30)34-5)37-22-26-16-8-7-9-17-26/h7-9,12,15-20H,6,10-11,13-14,21-22H2,1-5H3/b23-12+,24-18+,25-15+ |
| InChIKey | YZJGIFDFHWAUER-ZPBHQLHNSA-N |
| XLogP | 8.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|