C28H29N3O8S — CID 71713845
9H-fluoren-9-ylmethyl N-[(2S)-3-[(2-methylpropan-2-yl)oxy]-1-[(4-nitrophenyl)sulfonylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 71713845) has the molecular formula C28H29N3O8S and a molecular weight of 567.62 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-3-[(2-methylpropan-2-yl)oxy]-1-[(4-nitrophenyl)sulfonylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-3-[(2-methylpropan-2-yl)oxy]-1-[(4-nitrophenyl)sulfonylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 71713845 |
| Molecular Formula | C28H29N3O8S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-3-[(2-methylpropan-2-yl)oxy]-1-[(4-nitrophenyl)sulfonylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29N3O8S/c1-28(2,3)39-17-25(26(32)30-40(36,37)19-14-12-18(13-15-19)31(34)35)29-27(33)38-16-24-22-10-6-4-8-20(22)21-9-5-7-11-23(21)24/h4-15,24-25H,16-17H2,1-3H3,(H,29,33)(H,30,32)/t25-/m0/s1 |
| InChIKey | QCTYCVRJPYKOSB-VWLOTQADSA-N |
| XLogP | 4.12 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|