C29H31N3O7 — CID 101169462
(4-nitrophenyl) N-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propyl]carbamate (PubChem CID 101169462) has the molecular formula C29H31N3O7 and a molecular weight of 533.58 g/mol. Its IUPAC name is (4-nitrophenyl) N-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propyl]carbamate |
|---|---|
| PubChem CID | 101169462 |
| Molecular Formula | C29H31N3O7 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | (4-nitrophenyl) N-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propyl]carbamate |
| SMILES | CC(C)(C)OC[C@H](CNC(=O)Oc1ccc([N+](=O)[O-])cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H31N3O7/c1-29(2,3)38-17-19(16-30-27(33)39-21-14-12-20(13-15-21)32(35)36)31-28(34)37-18-26-24-10-6-4-8-22(24)23-9-5-7-11-25(23)26/h4-15,19,26H,16-18H2,1-3H3,(H,30,33)(H,31,34)/t19-/m0/s1 |
| InChIKey | FPHCCGMBJRWUSE-IBGZPJMESA-N |
| XLogP | 5.41 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|