C13H13FN2O4S — CID 71714092
S-[2-(2-fluoroanilino)-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamothioate (PubChem CID 71714092) has the molecular formula C13H13FN2O4S and a molecular weight of 312.32 g/mol. Its IUPAC name is S-[2-(2-fluoroanilino)-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamothioate.
| Compound Name | S-[2-(2-fluoroanilino)-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamothioate |
|---|---|
| PubChem CID | 71714092 |
| Molecular Formula | C13H13FN2O4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | S-[2-(2-fluoroanilino)-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamothioate |
| SMILES | O=C(CSC(=O)N[C@H]1CCOC1=O)Nc1ccccc1F |
| InChI | InChI=1S/C13H13FN2O4S/c14-8-3-1-2-4-9(8)15-11(17)7-21-13(19)16-10-5-6-20-12(10)18/h1-4,10H,5-7H2,(H,15,17)(H,16,19)/t10-/m0/s1 |
| InChIKey | OHESDCBAENSQGR-JTQLQIEISA-N |
| XLogP | 1.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|