C15H17N3O5S2 — CID 171349734
[2-[(2-methoxyphenyl)carbamoylamino]-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamodithioate (PubChem CID 171349734) has the molecular formula C15H17N3O5S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)carbamoylamino]-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamodithioate.
| Compound Name | [2-[(2-methoxyphenyl)carbamoylamino]-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamodithioate |
|---|---|
| PubChem CID | 171349734 |
| Molecular Formula | C15H17N3O5S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | [2-[(2-methoxyphenyl)carbamoylamino]-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamodithioate |
| SMILES | COc1ccccc1NC(=O)NC(=O)CSC(=S)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C15H17N3O5S2/c1-22-11-5-3-2-4-9(11)16-14(21)18-12(19)8-25-15(24)17-10-6-7-23-13(10)20/h2-5,10H,6-8H2,1H3,(H,17,24)(H2,16,18,19,21)/t10-/m0/s1 |
| InChIKey | NJXGGQIRVKYVOO-JTQLQIEISA-N |
| XLogP | 1.27 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|