C14H16N2O4S2 — CID 73356645
[2-(4-methoxyanilino)-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamodithioate (PubChem CID 73356645) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamodithioate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamodithioate |
|---|---|
| PubChem CID | 73356645 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] N-[(3S)-2-oxooxolan-3-yl]carbamodithioate |
| SMILES | COc1ccc(NC(=O)CSC(=S)N[C@H]2CCOC2=O)cc1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-19-10-4-2-9(3-5-10)15-12(17)8-22-14(21)16-11-6-7-20-13(11)18/h2-5,11H,6-8H2,1H3,(H,15,17)(H,16,21)/t11-/m0/s1 |
| InChIKey | HNIJYJONEMOCKW-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|