C22H24ClN3O6 — CID 71714644
1-(3-chlorophenyl)-3-[2-[[2-hydroxy-3-(4-methoxy-2-oxochromen-7-yl)oxypropyl]amino]ethyl]urea (PubChem CID 71714644) has the molecular formula C22H24ClN3O6 and a molecular weight of 461.90 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[2-[[2-hydroxy-3-(4-methoxy-2-oxochromen-7-yl)oxypropyl]amino]ethyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[2-[[2-hydroxy-3-(4-methoxy-2-oxochromen-7-yl)oxypropyl]amino]ethyl]urea |
|---|---|
| PubChem CID | 71714644 |
| Molecular Formula | C22H24ClN3O6 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[2-[[2-hydroxy-3-(4-methoxy-2-oxochromen-7-yl)oxypropyl]amino]ethyl]urea |
| SMILES | COc1cc(=O)oc2cc(OCC(O)CNCCNC(=O)Nc3cccc(Cl)c3)ccc12 |
| InChI | InChI=1S/C22H24ClN3O6/c1-30-19-11-21(28)32-20-10-17(5-6-18(19)20)31-13-16(27)12-24-7-8-25-22(29)26-15-4-2-3-14(23)9-15/h2-6,9-11,16,24,27H,7-8,12-13H2,1H3,(H2,25,26,29) |
| InChIKey | SMEOUBZNUPUIHP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|