C20H21ClF3NO — CID 71720664
4-[[3-chloro-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine (PubChem CID 71720664) has the molecular formula C20H21ClF3NO and a molecular weight of 383.84 g/mol. Its IUPAC name is 4-[[3-chloro-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine.
| Compound Name | 4-[[3-chloro-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine |
|---|---|
| PubChem CID | 71720664 |
| Molecular Formula | C20H21ClF3NO |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-[[3-chloro-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine |
| SMILES | FC(F)(F)c1cc(Cl)cc(COCC2(c3ccccc3)CCNCC2)c1 |
| InChI | InChI=1S/C20H21ClF3NO/c21-18-11-15(10-17(12-18)20(22,23)24)13-26-14-19(6-8-25-9-7-19)16-4-2-1-3-5-16/h1-5,10-12,25H,6-9,13-14H2 |
| InChIKey | WWDAJXARVJHRBI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |