C22H29NO6 — CID 71725812
(4R,5S)-3-[(3S)-3-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 71725812) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is (4R,5S)-3-[(3S)-3-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(3S)-3-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71725812 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (4R,5S)-3-[(3S)-3-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1[C@@H](O)C(C)(C)C(=O)N1C(=O)O[C@@H](C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H29NO6/c1-7-15-17(29-22(5,6)28-15)18(24)21(3,4)19(25)23-16(13(2)27-20(23)26)14-11-9-8-10-12-14/h7-13,15-18,24H,1H2,2-6H3/t13-,15-,16-,17-,18+/m0/s1 |
| InChIKey | KNBMNYUWBUNTIF-PEJOBZMASA-N |
| XLogP | 3.19 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|