C25H35NO6 — CID 44604558
(4R)-3-[(E,2S,3S)-3-hydroxy-2-methyl-5-[(4S,5S,6S)-2,2,5-trimethyl-6-propyl-1,3-dioxan-4-yl]pent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 44604558) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is (4R)-3-[(E,2S,3S)-3-hydroxy-2-methyl-5-[(4S,5S,6S)-2,2,5-trimethyl-6-propyl-1,3-dioxan-4-yl]pent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(E,2S,3S)-3-hydroxy-2-methyl-5-[(4S,5S,6S)-2,2,5-trimethyl-6-propyl-1,3-dioxan-4-yl]pent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 44604558 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (4R)-3-[(E,2S,3S)-3-hydroxy-2-methyl-5-[(4S,5S,6S)-2,2,5-trimethyl-6-propyl-1,3-dioxan-4-yl]pent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@@H]1OC(C)(C)O[C@@H](/C=C/[C@H](O)[C@H](C)C(=O)N2C(=O)OC[C@H]2c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C25H35NO6/c1-6-10-21-17(3)22(32-25(4,5)31-21)14-13-20(27)16(2)23(28)26-19(15-30-24(26)29)18-11-8-7-9-12-18/h7-9,11-14,16-17,19-22,27H,6,10,15H2,1-5H3/b14-13+/t16-,17-,19-,20-,21-,22-/m0/s1 |
| InChIKey | RABIWWHYWWDMEG-QZVLNLJDSA-N |
| XLogP | 4.22 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|