C16H32O4Si — CID 71725894
(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]ethanol (PubChem CID 71725894) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is (1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 71725894 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]ethanol |
| SMILES | C=C(C)[C@H]1OC(C)(C)O[C@@H]1[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-11(2)13-14(20-16(6,7)19-13)12(17)10-18-21(8,9)15(3,4)5/h12-14,17H,1,10H2,2-9H3/t12-,13-,14-/m1/s1 |
| InChIKey | VKRCECGNARYWKS-MGPQQGTHSA-N |
| XLogP | 3.47 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|