C19H38O6Si — CID 11047426
(1R)-1-[(2S,3R,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-3-en-1-ol (PubChem CID 11047426) has the molecular formula C19H38O6Si and a molecular weight of 390.59 g/mol. Its IUPAC name is (1R)-1-[(2S,3R,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-3-en-1-ol.
| Compound Name | (1R)-1-[(2S,3R,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 11047426 |
| Molecular Formula | C19H38O6Si |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (1R)-1-[(2S,3R,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-3-en-1-ol |
| SMILES | C=CC[C@@H](O)[C@@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O6Si/c1-11-12-14(20)16-15(13-23-26(9,10)17(2,3)4)24-18(5,21-7)19(6,22-8)25-16/h11,14-16,20H,1,12-13H2,2-10H3/t14-,15-,16+,18-,19-/m1/s1 |
| InChIKey | JYBDYNWPMINRAY-WCWVYFQPSA-N |
| XLogP | 3.45 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|