C19H28O3 — CID 71725956
(3E,7E,9Z,11S,12R)-12-[(E,4S,5R)-5-hydroxy-4-methylhex-2-en-2-yl]-11-methyl-1-oxacyclododeca-3,7,9-trien-2-one (PubChem CID 71725956) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (3E,7E,9Z,11S,12R)-12-[(E,4S,5R)-5-hydroxy-4-methylhex-2-en-2-yl]-11-methyl-1-oxacyclododeca-3,7,9-trien-2-one.
| Compound Name | (3E,7E,9Z,11S,12R)-12-[(E,4S,5R)-5-hydroxy-4-methylhex-2-en-2-yl]-11-methyl-1-oxacyclododeca-3,7,9-trien-2-one |
|---|---|
| PubChem CID | 71725956 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (3E,7E,9Z,11S,12R)-12-[(E,4S,5R)-5-hydroxy-4-methylhex-2-en-2-yl]-11-methyl-1-oxacyclododeca-3,7,9-trien-2-one |
| SMILES | C/C(=C\[C@H](C)[C@@H](C)O)[C@@H]1OC(=O)/C=C/CC/C=C/C=C\[C@@H]1C |
| InChI | InChI=1S/C19H28O3/c1-14-11-9-7-5-6-8-10-12-18(21)22-19(14)16(3)13-15(2)17(4)20/h5,7,9-15,17,19-20H,6,8H2,1-4H3/b7-5+,11-9-,12-10+,16-13+/t14-,15-,17+,19+/m0/s1 |
| InChIKey | BYKXFKRUPUUDIG-VMXDUNGCSA-N |
| XLogP | 3.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|