About N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine
N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine (PubChem CID 71726401) has the molecular formula C7H7N3O5
and a molecular weight of 218.18 g/mol. Its IUPAC name is N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine |
| PubChem CID | 71726401 |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine |
| SMILES | [2H]c1c(NO)c([2H])c([N+](=O)[O-])c(C([2H])([2H])[2H])c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O5/c1-4-6(9(12)13)2-5(8-11)3-7(4)10(14)15/h2-3,8,11H,1H3/i1D3,2D,3D |
| InChIKey | HTTDEAQRSCMCQS-RHIBPKLGSA-N |
| XLogP | 1.61 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine?
The IUPAC name of N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine (CID 71726401) is N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine.
What is the SMILES notation for N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine?
The canonical SMILES for N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine is [2H]c1c(NO)c([2H])c([N+](=O)[O-])c(C([2H])([2H])[2H])c1[N+](=O)[O-].
What is the InChIKey of N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine?
The InChIKey is HTTDEAQRSCMCQS-RHIBPKLGSA-N. The full InChI is InChI=1S/C7H7N3O5/c1-4-6(9(12)13)2-5(8-11)3-7(4)10(14)15/h2-3,8,11H,1H3/i1D3,2D,3D.
What are the key properties of N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine?
N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine has a molecular weight of 218.18 g/mol, XLogP of 1.61, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-dideuterio-3,5-dinitro-4-(trideuteriomethyl)phenyl]hydroxylamine is sourced from PubChem (CID 71726401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).