C14H21NO3 — CID 155614260
2,5-dideuterio-4,6-bis[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-nitrophenol (PubChem CID 155614260) has the molecular formula C14H21NO3 and a molecular weight of 271.45 g/mol. Its IUPAC name is 2,5-dideuterio-4,6-bis[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-nitrophenol.
| Compound Name | 2,5-dideuterio-4,6-bis[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-nitrophenol |
|---|---|
| PubChem CID | 155614260 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.28 |
| IUPAC Name | 2,5-dideuterio-4,6-bis[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-nitrophenol |
| SMILES | [2H]c1c(O)c(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c([2H])c(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21NO3/c1-13(2,3)9-7-10(14(4,5)6)12(16)8-11(9)15(17)18/h7-8,16H,1-6H3/i1D3,2D3,3D3,4D3,5D3,6D3,7D,8D |
| InChIKey | VIWYWRSFQRIVPI-ZYCJINFJSA-N |
| XLogP | 3.90 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|