About [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate
[(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate (PubChem CID 71728262) has the molecular formula C19H37NO4Si
and a molecular weight of 371.59 g/mol. Its IUPAC name is [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate.
Molecular Properties
| Compound Name | [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate |
| PubChem CID | 71728262 |
| Molecular Formula | C19H37NO4Si |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate |
| SMILES | CCCC[Si](CCCC)(CCCC)OC(C)[C@H]1C(=O)N[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H37NO4Si/c1-6-9-12-25(13-10-7-2,14-11-8-3)24-15(4)17-18(22)20-19(17)23-16(5)21/h15,17,19H,6-14H2,1-5H3,(H,20,22)/t15?,17-,19+/m0/s1 |
| InChIKey | IGCFGKKRCYNOKY-IYSUZNMVSA-N |
| XLogP | 4.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate?
The IUPAC name of [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate (CID 71728262) is [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate.
What is the SMILES notation for [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate?
The canonical SMILES for [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate is CCCC[Si](CCCC)(CCCC)OC(C)[C@H]1C(=O)N[C@@H]1OC(C)=O.
What is the InChIKey of [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate?
The InChIKey is IGCFGKKRCYNOKY-IYSUZNMVSA-N. The full InChI is InChI=1S/C19H37NO4Si/c1-6-9-12-25(13-10-7-2,14-11-8-3)24-15(4)17-18(22)20-19(17)23-16(5)21/h15,17,19H,6-14H2,1-5H3,(H,20,22)/t15?,17-,19+/m0/s1.
What are the key properties of [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate?
[(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate has a molecular weight of 371.59 g/mol, XLogP of 4.37, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-4-oxo-3-(1-tributylsilyloxyethyl)azetidin-2-yl] acetate is sourced from PubChem (CID 71728262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).