C16H19N3O5 — CID 7173029
4-O-[(3R)-3-cyano-4-imino-2-oxopentyl] 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 7173029) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-O-[(3R)-3-cyano-4-imino-2-oxopentyl] 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 4-O-[(3R)-3-cyano-4-imino-2-oxopentyl] 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7173029 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-O-[(3R)-3-cyano-4-imino-2-oxopentyl] 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)COC(=O)c1c(C)[nH]c(C(=O)OCC)c1C |
| InChI | InChI=1S/C16H19N3O5/c1-5-23-16(22)14-8(2)13(10(4)19-14)15(21)24-7-12(20)11(6-17)9(3)18/h11,18-19H,5,7H2,1-4H3/b18-9+/t11-/m0/s1 |
| InChIKey | UCRXFFLKWNVGFC-KECVIQKOSA-N |
| XLogP | 1.71 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|