C26H27F2N3O3 — CID 71730475
1-[3-(4-fluorophenyl)-3-(4-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)propanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxylic acid (PubChem CID 71730475) has the molecular formula C26H27F2N3O3 and a molecular weight of 467.52 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)-3-(4-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)propanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxylic acid.
| Compound Name | 1-[3-(4-fluorophenyl)-3-(4-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)propanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 71730475 |
| Molecular Formula | C26H27F2N3O3 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 1-[3-(4-fluorophenyl)-3-(4-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)propanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)CC(c2ccc(F)cc2)c2c[nH]c3nccc(F)c23)C2CCCCC12 |
| InChI | InChI=1S/C26H27F2N3O3/c27-16-7-5-15(6-8-16)19(20-14-30-25-24(20)21(28)9-11-29-25)13-23(32)31-12-10-18(26(33)34)17-3-1-2-4-22(17)31/h5-9,11,14,17-19,22H,1-4,10,12-13H2,(H,29,30)(H,33,34) |
| InChIKey | HHGJZBFWPWUXMB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |