C20H28FN3O2 — CID 98755493
1-[2-[(4R,4aS,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 98755493) has the molecular formula C20H28FN3O2 and a molecular weight of 361.46 g/mol. Its IUPAC name is 1-[2-[(4R,4aS,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[2-[(4R,4aS,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 98755493 |
| Molecular Formula | C20H28FN3O2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[2-[(4R,4aS,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | C[C@@H]1CCN(C(=O)CNC(=O)NCc2ccc(F)cc2)[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C20H28FN3O2/c1-14-10-11-24(18-5-3-2-4-17(14)18)19(25)13-23-20(26)22-12-15-6-8-16(21)9-7-15/h6-9,14,17-18H,2-5,10-13H2,1H3,(H2,22,23,26)/t14-,17+,18+/m1/s1 |
| InChIKey | SAUOEMPKOWJRDA-JLSDUUJJSA-N |
| XLogP | 3.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |