C20H24FN5O5 — CID 55834652
1-[2-[4-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]piperazin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 55834652) has the molecular formula C20H24FN5O5 and a molecular weight of 433.44 g/mol. Its IUPAC name is 1-[2-[4-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]piperazin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[2-[4-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]piperazin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 55834652 |
| Molecular Formula | C20H24FN5O5 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-[2-[4-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]piperazin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(NCC(=O)N1CCN(C(=O)CN2C(=O)CCC2=O)CC1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FN5O5/c21-15-3-1-14(2-4-15)11-22-20(31)23-12-18(29)24-7-9-25(10-8-24)19(30)13-26-16(27)5-6-17(26)28/h1-4H,5-13H2,(H2,22,23,31) |
| InChIKey | OWPLVKPNWVBXLU-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|