C21H10ClF6N3OS — CID 71732778
3-[3,5-bis(trifluoromethyl)phenyl]-1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde (PubChem CID 71732778) has the molecular formula C21H10ClF6N3OS and a molecular weight of 501.84 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 71732778 |
| Molecular Formula | C21H10ClF6N3OS |
| Molecular Weight | 501.84 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn(-c2nc(-c3ccc(Cl)cc3)cs2)nc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H10ClF6N3OS/c22-16-3-1-11(2-4-16)17-10-33-19(29-17)31-8-13(9-32)18(30-31)12-5-14(20(23,24)25)7-15(6-12)21(26,27)28/h1-10H |
| InChIKey | HAMMCDDABFJUBP-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.84 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|