C22H10Cl3N3O3S — CID 127038435
3-(4-chlorophenyl)-1-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde (PubChem CID 127038435) has the molecular formula C22H10Cl3N3O3S and a molecular weight of 502.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde.
| Compound Name | 3-(4-chlorophenyl)-1-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 127038435 |
| Molecular Formula | C22H10Cl3N3O3S |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 500.95 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn(-c2nc(-c3cc4cc(Cl)cc(Cl)c4oc3=O)cs2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H10Cl3N3O3S/c23-14-3-1-11(2-4-14)19-13(9-29)8-28(27-19)22-26-18(10-32-22)16-6-12-5-15(24)7-17(25)20(12)31-21(16)30/h1-10H |
| InChIKey | YOBMXFBNTOAJGA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|