C27H16ClF3O5 — CID 71734922
6-[2-(3-chlorophenyl)ethynyl]-2,2-dimethyl-7-[4-(trifluoromethoxy)phenyl]furo[3,2-g][1,3]benzodioxin-4-one (PubChem CID 71734922) has the molecular formula C27H16ClF3O5 and a molecular weight of 512.87 g/mol. Its IUPAC name is 6-[2-(3-chlorophenyl)ethynyl]-2,2-dimethyl-7-[4-(trifluoromethoxy)phenyl]furo[3,2-g][1,3]benzodioxin-4-one.
| Compound Name | 6-[2-(3-chlorophenyl)ethynyl]-2,2-dimethyl-7-[4-(trifluoromethoxy)phenyl]furo[3,2-g][1,3]benzodioxin-4-one |
|---|---|
| PubChem CID | 71734922 |
| Molecular Formula | C27H16ClF3O5 |
| Molecular Weight | 512.87 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 6-[2-(3-chlorophenyl)ethynyl]-2,2-dimethyl-7-[4-(trifluoromethoxy)phenyl]furo[3,2-g][1,3]benzodioxin-4-one |
| SMILES | CC1(C)OC(=O)c2cc3c(C#Cc4cccc(Cl)c4)c(-c4ccc(OC(F)(F)F)cc4)oc3cc2O1 |
| InChI | InChI=1S/C27H16ClF3O5/c1-26(2)35-23-14-22-20(13-21(23)25(32)36-26)19(11-6-15-4-3-5-17(28)12-15)24(33-22)16-7-9-18(10-8-16)34-27(29,30)31/h3-5,7-10,12-14H,1-2H3 |
| InChIKey | ZXTNLBLFEWQFKD-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.87 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|