C19H29NO5 — CID 71735844
2-(2-hydroxyethylamino)ethanol;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid (PubChem CID 71735844) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid.
| Compound Name | 2-(2-hydroxyethylamino)ethanol;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 71735844 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CC2CCCC2=O)cc1.OCCNCCO |
| InChI | InChI=1S/C15H18O3.C4H11NO2/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16;6-3-1-5-2-4-7/h5-8,10,13H,2-4,9H2,1H3,(H,17,18);5-7H,1-4H2 |
| InChIKey | PCIBWPYAOCUCBK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|