C18H24O2 — CID 118474303
2-[[4-[(2S)-4-methyl-3-oxopentan-2-yl]phenyl]methyl]cyclopentan-1-one (PubChem CID 118474303) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-[[4-[(2S)-4-methyl-3-oxopentan-2-yl]phenyl]methyl]cyclopentan-1-one.
| Compound Name | 2-[[4-[(2S)-4-methyl-3-oxopentan-2-yl]phenyl]methyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 118474303 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-[[4-[(2S)-4-methyl-3-oxopentan-2-yl]phenyl]methyl]cyclopentan-1-one |
| SMILES | CC(C)C(=O)[C@@H](C)c1ccc(CC2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H24O2/c1-12(2)18(20)13(3)15-9-7-14(8-10-15)11-16-5-4-6-17(16)19/h7-10,12-13,16H,4-6,11H2,1-3H3/t13-,16?/m0/s1 |
| InChIKey | XALHECVNLGCQEC-KNVGNIICSA-N |
| XLogP | 3.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |