C15H12O5S3 — CID 71737434
4-[2-sulfanyl-2-(4-sulfophenyl)ethanethioyl]benzoic acid (PubChem CID 71737434) has the molecular formula C15H12O5S3 and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-[2-sulfanyl-2-(4-sulfophenyl)ethanethioyl]benzoic acid.
| Compound Name | 4-[2-sulfanyl-2-(4-sulfophenyl)ethanethioyl]benzoic acid |
|---|---|
| PubChem CID | 71737434 |
| Molecular Formula | C15H12O5S3 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 4-[2-sulfanyl-2-(4-sulfophenyl)ethanethioyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=S)C(S)c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C15H12O5S3/c16-15(17)11-3-1-9(2-4-11)13(21)14(22)10-5-7-12(8-6-10)23(18,19)20/h1-8,14,22H,(H,16,17)(H,18,19,20) |
| InChIKey | WLAJWWHTYDRSID-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|