C10H10N2O2S2 — CID 87454060
4-[1,3-diamino-1,3-bis(sulfanylidene)propan-2-yl]benzoic acid (PubChem CID 87454060) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 4-[1,3-diamino-1,3-bis(sulfanylidene)propan-2-yl]benzoic acid.
| Compound Name | 4-[1,3-diamino-1,3-bis(sulfanylidene)propan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 87454060 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 4-[1,3-diamino-1,3-bis(sulfanylidene)propan-2-yl]benzoic acid |
| SMILES | NC(=S)C(C(N)=S)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C10H10N2O2S2/c11-8(15)7(9(12)16)5-1-3-6(4-2-5)10(13)14/h1-4,7H,(H2,11,15)(H2,12,16)(H,13,14) |
| InChIKey | NPTBPKZXVWIDEB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|