C25H31N5O — CID 71738090
1-benzyl-3-(2-cyclohexyl-6-pyrrolidin-1-yl-3H-benzimidazol-5-yl)urea (PubChem CID 71738090) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 1-benzyl-3-(2-cyclohexyl-6-pyrrolidin-1-yl-3H-benzimidazol-5-yl)urea.
| Compound Name | 1-benzyl-3-(2-cyclohexyl-6-pyrrolidin-1-yl-3H-benzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 71738090 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 1-benzyl-3-(2-cyclohexyl-6-pyrrolidin-1-yl-3H-benzimidazol-5-yl)urea |
| SMILES | O=C(NCc1ccccc1)Nc1cc2[nH]c(C3CCCCC3)nc2cc1N1CCCC1 |
| InChI | InChI=1S/C25H31N5O/c31-25(26-17-18-9-3-1-4-10-18)29-22-15-20-21(16-23(22)30-13-7-8-14-30)28-24(27-20)19-11-5-2-6-12-19/h1,3-4,9-10,15-16,19H,2,5-8,11-14,17H2,(H,27,28)(H2,26,29,31) |
| InChIKey | KJPYYICHEBJETB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |