C23H23ClN2O5S — CID 71738778
4-chloro-N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethylamino]methyl]phenyl]benzenesulfonamide (PubChem CID 71738778) has the molecular formula C23H23ClN2O5S and a molecular weight of 474.97 g/mol. Its IUPAC name is 4-chloro-N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethylamino]methyl]phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethylamino]methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71738778 |
| Molecular Formula | C23H23ClN2O5S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 4-chloro-N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethylamino]methyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CNCCOc2cccc3c2OCCO3)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN2O5S/c24-18-7-9-20(10-8-18)32(27,28)26-19-4-1-3-17(15-19)16-25-11-12-29-21-5-2-6-22-23(21)31-14-13-30-22/h1-10,15,25-26H,11-14,16H2 |
| InChIKey | ZEMFPDUFYXZDNE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|