C27H30ClN3O5S — CID 71739950
3-[[benzyl(ethyl)carbamoyl]amino]-5-[4-chloro-3-[4-(methoxycarbonylamino)butyl]phenyl]thiophene-2-carboxylic acid (PubChem CID 71739950) has the molecular formula C27H30ClN3O5S and a molecular weight of 544.07 g/mol. Its IUPAC name is 3-[[benzyl(ethyl)carbamoyl]amino]-5-[4-chloro-3-[4-(methoxycarbonylamino)butyl]phenyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[benzyl(ethyl)carbamoyl]amino]-5-[4-chloro-3-[4-(methoxycarbonylamino)butyl]phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 71739950 |
| Molecular Formula | C27H30ClN3O5S |
| Molecular Weight | 544.07 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 3-[[benzyl(ethyl)carbamoyl]amino]-5-[4-chloro-3-[4-(methoxycarbonylamino)butyl]phenyl]thiophene-2-carboxylic acid |
| SMILES | CCN(Cc1ccccc1)C(=O)Nc1cc(-c2ccc(Cl)c(CCCCNC(=O)OC)c2)sc1C(=O)O |
| InChI | InChI=1S/C27H30ClN3O5S/c1-3-31(17-18-9-5-4-6-10-18)26(34)30-22-16-23(37-24(22)25(32)33)20-12-13-21(28)19(15-20)11-7-8-14-29-27(35)36-2/h4-6,9-10,12-13,15-16H,3,7-8,11,14,17H2,1-2H3,(H,29,35)(H,30,34)(H,32,33) |
| InChIKey | KRUZIKIISAHBEF-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.07 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|