C11H13F3N2O4 — CID 71744697
(2,5-dioxopyrrolidin-1-yl) 2-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 71744697) has the molecular formula C11H13F3N2O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71744697 |
| Molecular Formula | C11H13F3N2O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | O=C1CCC(=O)N1OC(=O)N1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O4/c12-11(13,14)7-3-1-2-6-15(7)10(19)20-16-8(17)4-5-9(16)18/h7H,1-6H2 |
| InChIKey | CHGZJFFLOPTVFS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|