About (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one
(2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one (PubChem CID 71745270) has the molecular formula C14H12F2O3
and a molecular weight of 266.24 g/mol. Its IUPAC name is (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one.
Molecular Properties
| Compound Name | (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one |
| PubChem CID | 71745270 |
| Molecular Formula | C14H12F2O3 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one |
| SMILES | COc1ccccc1/C=C/[C@H]1OC(=O)C=CC1(F)F |
| InChI | InChI=1S/C14H12F2O3/c1-18-11-5-3-2-4-10(11)6-7-12-14(15,16)9-8-13(17)19-12/h2-9,12H,1H3/b7-6+/t12-/m1/s1 |
| InChIKey | IXOKVJDFVZKAAB-NNNHXZLVSA-N |
| XLogP | 2.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one?
The IUPAC name of (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one (CID 71745270) is (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one.
What is the SMILES notation for (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one?
The canonical SMILES for (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one is COc1ccccc1/C=C/[C@H]1OC(=O)C=CC1(F)F.
What is the InChIKey of (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one?
The InChIKey is IXOKVJDFVZKAAB-NNNHXZLVSA-N. The full InChI is InChI=1S/C14H12F2O3/c1-18-11-5-3-2-4-10(11)6-7-12-14(15,16)9-8-13(17)19-12/h2-9,12H,1H3/b7-6+/t12-/m1/s1.
What are the key properties of (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one?
(2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one has a molecular weight of 266.24 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,3-difluoro-2-[(E)-2-(2-methoxyphenyl)ethenyl]-2H-pyran-6-one is sourced from PubChem (CID 71745270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).