C12H13BrNO5S- — CID 7174653
3-bromo-5-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate (PubChem CID 7174653) has the molecular formula C12H13BrNO5S- and a molecular weight of 363.21 g/mol. Its IUPAC name is 3-bromo-5-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate.
| Compound Name | 3-bromo-5-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 7174653 |
| Molecular Formula | C12H13BrNO5S- |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 3-bromo-5-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate |
| SMILES | O=C([O-])c1cc(Br)cc(S(=O)(=O)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C12H14BrNO5S/c13-9-4-8(12(15)16)5-11(6-9)20(17,18)14-7-10-2-1-3-19-10/h4-6,10,14H,1-3,7H2,(H,15,16)/p-1/t10-/m0/s1 |
| InChIKey | ZARANOWLGWMYGK-JTQLQIEISA-M |
| XLogP | 0.27 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |