C17H19F3N2O5S — CID 71748011
N-[4-amino-2-[(2,5-dimethoxyphenyl)methoxy]phenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide (PubChem CID 71748011) has the molecular formula C17H19F3N2O5S and a molecular weight of 420.41 g/mol. Its IUPAC name is N-[4-amino-2-[(2,5-dimethoxyphenyl)methoxy]phenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide.
| Compound Name | N-[4-amino-2-[(2,5-dimethoxyphenyl)methoxy]phenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 71748011 |
| Molecular Formula | C17H19F3N2O5S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-[4-amino-2-[(2,5-dimethoxyphenyl)methoxy]phenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide |
| SMILES | COc1ccc(OC)c(COc2cc(N)ccc2N(C)S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19F3N2O5S/c1-22(28(23,24)17(18,19)20)14-6-4-12(21)9-16(14)27-10-11-8-13(25-2)5-7-15(11)26-3/h4-9H,10,21H2,1-3H3 |
| InChIKey | JTYNPEWKYZOZFK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|