C16H19N — CID 71751168
N-benzyl-1,1,1,2,3,3-hexadeuterio-3-phenylpropan-2-amine (PubChem CID 71751168) has the molecular formula C16H19N and a molecular weight of 231.37 g/mol. Its IUPAC name is N-benzyl-1,1,1,2,3,3-hexadeuterio-3-phenylpropan-2-amine.
| Compound Name | N-benzyl-1,1,1,2,3,3-hexadeuterio-3-phenylpropan-2-amine |
|---|---|
| PubChem CID | 71751168 |
| Molecular Formula | C16H19N |
| Molecular Weight | 231.37 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | N-benzyl-1,1,1,2,3,3-hexadeuterio-3-phenylpropan-2-amine |
| SMILES | [2H]C([2H])([2H])C([2H])(NCc1ccccc1)C([2H])([2H])c1ccccc1 |
| InChI | InChI=1S/C16H19N/c1-14(12-15-8-4-2-5-9-15)17-13-16-10-6-3-7-11-16/h2-11,14,17H,12-13H2,1H3/i1D3,12D2,14D |
| InChIKey | JLCDKDGHTWGGQM-JCKIRYGESA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |