C10H14 — CID 169068031
(1,1-dideuterio-2-methylpropyl)benzene (PubChem CID 169068031) has the molecular formula C10H14 and a molecular weight of 136.23 g/mol. Its IUPAC name is (1,1-dideuterio-2-methylpropyl)benzene.
| Compound Name | (1,1-dideuterio-2-methylpropyl)benzene |
|---|---|
| PubChem CID | 169068031 |
| Molecular Formula | C10H14 |
| Molecular Weight | 136.23 g/mol |
| Exact Mass | 136.12 |
| IUPAC Name | (1,1-dideuterio-2-methylpropyl)benzene |
| SMILES | [2H]C([2H])(c1ccccc1)C(C)C |
| InChI | InChI=1S/C10H14/c1-9(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3/i8D2 |
| InChIKey | KXUHSQYYJYAXGZ-MGVXTIMCSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |