C20H20O7 — CID 71753333
ethyl 3-(2H-chromen-3-yl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate (PubChem CID 71753333) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is ethyl 3-(2H-chromen-3-yl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate.
| Compound Name | ethyl 3-(2H-chromen-3-yl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate |
|---|---|
| PubChem CID | 71753333 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | ethyl 3-(2H-chromen-3-yl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate |
| SMILES | CCOC(=O)CC(C1=Cc2ccccc2OC1)c1oc(CO)cc(=O)c1O |
| InChI | InChI=1S/C20H20O7/c1-2-25-18(23)9-15(20-19(24)16(22)8-14(10-21)27-20)13-7-12-5-3-4-6-17(12)26-11-13/h3-8,15,21,24H,2,9-11H2,1H3 |
| InChIKey | ZAKZUVXXZZIYHP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |