C27H34N2O10 — CID 71754324
(2R,3S,4S,4aR,10bS)-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-7-[[4-(2-phenoxyethyl)piperazin-1-yl]methyl]-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one (PubChem CID 71754324) has the molecular formula C27H34N2O10 and a molecular weight of 546.57 g/mol. Its IUPAC name is (2R,3S,4S,4aR,10bS)-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-7-[[4-(2-phenoxyethyl)piperazin-1-yl]methyl]-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one.
| Compound Name | (2R,3S,4S,4aR,10bS)-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-7-[[4-(2-phenoxyethyl)piperazin-1-yl]methyl]-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one |
|---|---|
| PubChem CID | 71754324 |
| Molecular Formula | C27H34N2O10 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (2R,3S,4S,4aR,10bS)-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-7-[[4-(2-phenoxyethyl)piperazin-1-yl]methyl]-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one |
| SMILES | COc1c(O)c(CN2CCN(CCOc3ccccc3)CC2)c2c(c1O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1OC2=O |
| InChI | InChI=1S/C27H34N2O10/c1-36-25-20(31)16(13-29-9-7-28(8-10-29)11-12-37-15-5-3-2-4-6-15)18-19(22(25)33)24-26(39-27(18)35)23(34)21(32)17(14-30)38-24/h2-6,17,21,23-24,26,30-34H,7-14H2,1H3/t17-,21-,23+,24+,26-/m1/s1 |
| InChIKey | GPPNFRHQOAAGBZ-AFOYLGMVSA-N |
| XLogP | -0.00 |
| TPSA | 161.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|