C21H29NO9 — CID 123132605
3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-7-[(4-methylpiperidin-1-yl)methyl]-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one (PubChem CID 123132605) has the molecular formula C21H29NO9 and a molecular weight of 439.46 g/mol. Its IUPAC name is 3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-7-[(4-methylpiperidin-1-yl)methyl]-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one.
| Compound Name | 3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-7-[(4-methylpiperidin-1-yl)methyl]-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one |
|---|---|
| PubChem CID | 123132605 |
| Molecular Formula | C21H29NO9 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-7-[(4-methylpiperidin-1-yl)methyl]-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one |
| SMILES | COc1c(O)c(CN2CCC(C)CC2)c2c(c1O)C1OC(CO)C(O)C(O)C1OC2=O |
| InChI | InChI=1S/C21H29NO9/c1-9-3-5-22(6-4-9)7-10-12-13(16(26)19(29-2)14(10)24)18-20(31-21(12)28)17(27)15(25)11(8-23)30-18/h9,11,15,17-18,20,23-27H,3-8H2,1-2H3 |
| InChIKey | ORUOEMXUBNEZRA-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|