C26H31ClN2O9 — CID 90489205
(2R,3S,4S)-7-[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methyl]-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one (PubChem CID 90489205) has the molecular formula C26H31ClN2O9 and a molecular weight of 550.99 g/mol. Its IUPAC name is (2R,3S,4S)-7-[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methyl]-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one.
| Compound Name | (2R,3S,4S)-7-[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methyl]-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one |
|---|---|
| PubChem CID | 90489205 |
| Molecular Formula | C26H31ClN2O9 |
| Molecular Weight | 550.99 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | (2R,3S,4S)-7-[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methyl]-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one |
| SMILES | COc1c(O)c(CN2CCN(Cc3cccc(Cl)c3)CC2)c2c(c1O)C1O[C@H](CO)[C@@H](O)[C@H](O)C1OC2=O |
| InChI | InChI=1S/C26H31ClN2O9/c1-36-24-19(31)15(11-29-7-5-28(6-8-29)10-13-3-2-4-14(27)9-13)17-18(21(24)33)23-25(38-26(17)35)22(34)20(32)16(12-30)37-23/h2-4,9,16,20,22-23,25,30-34H,5-8,10-12H2,1H3/t16-,20-,22+,23?,25?/m1/s1 |
| InChIKey | BVIPIJBTIBJLJK-AJYMRWPVSA-N |
| XLogP | 0.77 |
| TPSA | 152.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.99 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|