C21H20O13 — CID 101261669
[(2R,3S,4R,4aR,10bS)-4,8,10-trihydroxy-2-(hydroxymethyl)-9-methoxy-6-oxo-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 101261669) has the molecular formula C21H20O13 and a molecular weight of 480.38 g/mol. Its IUPAC name is [(2R,3S,4R,4aR,10bS)-4,8,10-trihydroxy-2-(hydroxymethyl)-9-methoxy-6-oxo-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3S,4R,4aR,10bS)-4,8,10-trihydroxy-2-(hydroxymethyl)-9-methoxy-6-oxo-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 101261669 |
| Molecular Formula | C21H20O13 |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | [(2R,3S,4R,4aR,10bS)-4,8,10-trihydroxy-2-(hydroxymethyl)-9-methoxy-6-oxo-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | COc1c(O)cc2c(c1O)[C@@H]1O[C@H](CO)[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@H](O)[C@H]1OC2=O |
| InChI | InChI=1S/C21H20O13/c1-31-16-10(25)4-7-12(14(16)27)18-19(34-21(7)30)15(28)17(11(5-22)32-18)33-20(29)6-2-8(23)13(26)9(24)3-6/h2-4,11,15,17-19,22-28H,5H2,1H3/t11-,15+,17-,18+,19-/m1/s1 |
| InChIKey | DEJSEDTXBCUTDS-WHRCIOHNSA-N |
| XLogP | -0.22 |
| TPSA | 212.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|