C22H32O9 — CID 86300427
(2R,3S,4S,4aR,10bS)-8-(2-ethylhexoxy)-3,4,10-trihydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one (PubChem CID 86300427) has the molecular formula C22H32O9 and a molecular weight of 440.49 g/mol. Its IUPAC name is (2R,3S,4S,4aR,10bS)-8-(2-ethylhexoxy)-3,4,10-trihydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one.
| Compound Name | (2R,3S,4S,4aR,10bS)-8-(2-ethylhexoxy)-3,4,10-trihydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one |
|---|---|
| PubChem CID | 86300427 |
| Molecular Formula | C22H32O9 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (2R,3S,4S,4aR,10bS)-8-(2-ethylhexoxy)-3,4,10-trihydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one |
| SMILES | CCCCC(CC)COc1cc2c(c(O)c1OC)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1OC2=O |
| InChI | InChI=1S/C22H32O9/c1-4-6-7-11(5-2)10-29-13-8-12-15(17(25)19(13)28-3)20-21(31-22(12)27)18(26)16(24)14(9-23)30-20/h8,11,14,16,18,20-21,23-26H,4-7,9-10H2,1-3H3/t11?,14-,16-,18+,20+,21-/m1/s1 |
| InChIKey | IJOMBZRLHWXNAV-PKBMZPOKSA-N |
| XLogP | 1.69 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |