C19H27N3O9 — CID 163537747
(2R,3S,4S,4aR,10bS)-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one;1-azido-3-methylbutane (PubChem CID 163537747) has the molecular formula C19H27N3O9 and a molecular weight of 441.44 g/mol. Its IUPAC name is (2R,3S,4S,4aR,10bS)-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one;1-azido-3-methylbutane.
| Compound Name | (2R,3S,4S,4aR,10bS)-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one;1-azido-3-methylbutane |
|---|---|
| PubChem CID | 163537747 |
| Molecular Formula | C19H27N3O9 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (2R,3S,4S,4aR,10bS)-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one;1-azido-3-methylbutane |
| SMILES | CC(C)CCN=[N+]=[N-].COc1c(O)cc2c(c1O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1OC2=O |
| InChI | InChI=1S/C14H16O9.C5H11N3/c1-21-11-5(16)2-4-7(9(11)18)12-13(23-14(4)20)10(19)8(17)6(3-15)22-12;1-5(2)3-4-7-8-6/h2,6,8,10,12-13,15-19H,3H2,1H3;5H,3-4H2,1-2H3/t6-,8-,10+,12+,13-;/m1./s1 |
| InChIKey | DYLLYZYSPJBPGM-YOKSUNLASA-N |
| XLogP | 1.14 |
| TPSA | 194.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|