C29H22N2O3S — CID 71761280
N-dibenzofuran-3-yl-N'-dibenzothiophen-3-ylpentanediamide (PubChem CID 71761280) has the molecular formula C29H22N2O3S and a molecular weight of 478.57 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-N'-dibenzothiophen-3-ylpentanediamide.
| Compound Name | N-dibenzofuran-3-yl-N'-dibenzothiophen-3-ylpentanediamide |
|---|---|
| PubChem CID | 71761280 |
| Molecular Formula | C29H22N2O3S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-dibenzofuran-3-yl-N'-dibenzothiophen-3-ylpentanediamide |
| SMILES | O=C(CCCC(=O)Nc1ccc2c(c1)sc1ccccc12)Nc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C29H22N2O3S/c32-28(30-18-12-14-21-20-6-1-3-8-24(20)34-25(21)16-18)10-5-11-29(33)31-19-13-15-23-22-7-2-4-9-26(22)35-27(23)17-19/h1-4,6-9,12-17H,5,10-11H2,(H,30,32)(H,31,33) |
| InChIKey | XMKQDEQEHWFBKN-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |