C11H11N3O4S — CID 71761640
4-(4-formyl-5-methyl-3-oxo-1H-pyrazol-2-yl)benzenesulfonamide (PubChem CID 71761640) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is 4-(4-formyl-5-methyl-3-oxo-1H-pyrazol-2-yl)benzenesulfonamide.
| Compound Name | 4-(4-formyl-5-methyl-3-oxo-1H-pyrazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71761640 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 4-(4-formyl-5-methyl-3-oxo-1H-pyrazol-2-yl)benzenesulfonamide |
| SMILES | Cc1[nH]n(-c2ccc(S(N)(=O)=O)cc2)c(=O)c1C=O |
| InChI | InChI=1S/C11H11N3O4S/c1-7-10(6-15)11(16)14(13-7)8-2-4-9(5-3-8)19(12,17)18/h2-6,13H,1H3,(H2,12,17,18) |
| InChIKey | ZUDSJVNQOZHXAO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|