C23H19Cl2N5O3 — CID 71763537
N-[2-[(2,4-dichlorophenoxy)methyl]-4-oxoquinazolin-3-yl]-2-(2-phenylhydrazinyl)acetamide (PubChem CID 71763537) has the molecular formula C23H19Cl2N5O3 and a molecular weight of 484.34 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenoxy)methyl]-4-oxoquinazolin-3-yl]-2-(2-phenylhydrazinyl)acetamide.
| Compound Name | N-[2-[(2,4-dichlorophenoxy)methyl]-4-oxoquinazolin-3-yl]-2-(2-phenylhydrazinyl)acetamide |
|---|---|
| PubChem CID | 71763537 |
| Molecular Formula | C23H19Cl2N5O3 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | N-[2-[(2,4-dichlorophenoxy)methyl]-4-oxoquinazolin-3-yl]-2-(2-phenylhydrazinyl)acetamide |
| SMILES | O=C(CNNc1ccccc1)Nn1c(COc2ccc(Cl)cc2Cl)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H19Cl2N5O3/c24-15-10-11-20(18(25)12-15)33-14-21-27-19-9-5-4-8-17(19)23(32)30(21)29-22(31)13-26-28-16-6-2-1-3-7-16/h1-12,26,28H,13-14H2,(H,29,31) |
| InChIKey | UVYMZEYMGBKKGB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|